C22H17Cl2N3O2S — CID 45145516
2-[2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide (PubChem CID 45145516) has the molecular formula C22H17Cl2N3O2S and a molecular weight of 458.37 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 45145516 |
| Molecular Formula | C22H17Cl2N3O2S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2cccc3ccccc23)S/C1=N\c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H17Cl2N3O2S/c1-27-21(29)19(30-22(27)26-18-11-14(23)9-10-16(18)24)12-20(28)25-17-8-4-6-13-5-2-3-7-15(13)17/h2-11,19H,12H2,1H3,(H,25,28)/b26-22- |
| InChIKey | KFWZQJLWOIUKIR-ROMGYVFFSA-N |
| XLogP | 5.74 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|