C21H21Cl2N3O4S — CID 46802747
N-(2,3-dichlorophenyl)-2-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 46802747) has the molecular formula C21H21Cl2N3O4S and a molecular weight of 482.39 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 46802747 |
| Molecular Formula | C21H21Cl2N3O4S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[3-(2-methoxyethyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COCCN1C(=O)C(CC(=O)Nc2cccc(Cl)c2Cl)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O4S/c1-29-11-10-26-20(28)17(12-18(27)25-16-5-3-4-15(22)19(16)23)31-21(26)24-13-6-8-14(30-2)9-7-13/h3-9,17H,10-12H2,1-2H3,(H,25,27)/b24-21- |
| InChIKey | FQAGZUSGYRAXAW-FLFQWRMESA-N |
| XLogP | 4.61 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|