C23H25ClN4O3S — CID 5200597
N-(3-chlorophenyl)-2-[3-(2-morpholin-4-ylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 5200597) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[3-(2-morpholin-4-ylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[3-(2-morpholin-4-ylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 5200597 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-(3-chlorophenyl)-2-[3-(2-morpholin-4-ylethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1S/C(=N\c2ccccc2)N(CCN2CCOCC2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H25ClN4O3S/c24-17-5-4-8-19(15-17)25-21(29)16-20-22(30)28(10-9-27-11-13-31-14-12-27)23(32-20)26-18-6-2-1-3-7-18/h1-8,15,20H,9-14,16H2,(H,25,29)/b26-23- |
| InChIKey | GKBPEWAQXZAUSH-RWEWTDSWSA-N |
| XLogP | 3.63 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|