C22H25ClN4O4S2 — CID 25420594
N-(3-chlorophenyl)-2-[(5S)-2-[3-(dimethylsulfamoyl)phenyl]imino-4-oxo-3-propyl-1,3-thiazolidin-5-yl]acetamide (PubChem CID 25420594) has the molecular formula C22H25ClN4O4S2 and a molecular weight of 509.05 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5S)-2-[3-(dimethylsulfamoyl)phenyl]imino-4-oxo-3-propyl-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5S)-2-[3-(dimethylsulfamoyl)phenyl]imino-4-oxo-3-propyl-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 25420594 |
| Molecular Formula | C22H25ClN4O4S2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5S)-2-[3-(dimethylsulfamoyl)phenyl]imino-4-oxo-3-propyl-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCCN1C(=O)[C@H](CC(=O)Nc2cccc(Cl)c2)S/C1=N\c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H25ClN4O4S2/c1-4-11-27-21(29)19(14-20(28)24-16-8-5-7-15(23)12-16)32-22(27)25-17-9-6-10-18(13-17)33(30,31)26(2)3/h5-10,12-13,19H,4,11,14H2,1-3H3,(H,24,28)/b25-22-/t19-/m0/s1 |
| InChIKey | BKDHMPHWHYWXLB-NWIBBQCFSA-N |
| XLogP | 3.96 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|