C23H24ClN3O3S — CID 16555633
N-(3-chlorophenyl)-2-[2-(3-methylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 16555633) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-(3-methylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-(3-methylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 16555633 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-(3-methylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1cccc(/N=C2\SC(CC(=O)Nc3cccc(Cl)c3)C(=O)N2CC2CCCO2)c1 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-15-5-2-7-17(11-15)26-23-27(14-19-9-4-10-30-19)22(29)20(31-23)13-21(28)25-18-8-3-6-16(24)12-18/h2-3,5-8,11-12,19-20H,4,9-10,13-14H2,1H3,(H,25,28)/b26-23- |
| InChIKey | NNJBDXSNZCOXAT-RWEWTDSWSA-N |
| XLogP | 4.79 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|