C22H23N3O3S — CID 7432493
2-[(5R)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 7432493) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[(5R)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5R)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 7432493 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[(5R)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@H]1S/C(=N\c2ccccc2)N(C[C@H]2CCCO2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c26-20(23-16-8-3-1-4-9-16)14-19-21(27)25(15-18-12-7-13-28-18)22(29-19)24-17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2,(H,23,26)/b24-22-/t18-,19-/m1/s1 |
| InChIKey | UXEFXOSZOLNZBV-OULXMMDFSA-N |
| XLogP | 3.83 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|