C26H30N4O6S2 — CID 5165365
2-[2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 5165365) has the molecular formula C26H30N4O6S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 5165365 |
| Molecular Formula | C26H30N4O6S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 2-[2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1S/C(=N\c2ccc(S(=O)(=O)N3CCOCC3)cc2)N(CC2CCCO2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H30N4O6S2/c31-24(27-19-5-2-1-3-6-19)17-23-25(32)30(18-21-7-4-14-36-21)26(37-23)28-20-8-10-22(11-9-20)38(33,34)29-12-15-35-16-13-29/h1-3,5-6,8-11,21,23H,4,7,12-18H2,(H,27,31)/b28-26- |
| InChIKey | XAZJTXALIDBVNA-SGEDCAFJSA-N |
| XLogP | 2.85 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|