C16H18N2O4S — CID 1280321
2-[(5S)-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 1280321) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[(5S)-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5S)-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 1280321 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[(5S)-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1S/C(=N\c2ccccc2)N(C[C@@H]2CCCO2)C1=O |
| InChI | InChI=1S/C16H18N2O4S/c19-14(20)9-13-15(21)18(10-12-7-4-8-22-12)16(23-13)17-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H,19,20)/b17-16-/t12-,13-/m0/s1 |
| InChIKey | FAKPUXIKUOCWOI-DCFQSUQFSA-N |
| XLogP | 2.27 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|