C15H18N2O5S — CID 45145606
2-[3-(2,2-dimethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 45145606) has the molecular formula C15H18N2O5S and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-[3-(2,2-dimethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[3-(2,2-dimethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 45145606 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[3-(2,2-dimethoxyethyl)-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COC(CN1C(=O)C(CC(=O)O)S/C1=N\c1ccccc1)OC |
| InChI | InChI=1S/C15H18N2O5S/c1-21-13(22-2)9-17-14(20)11(8-12(18)19)23-15(17)16-10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3,(H,18,19)/b16-15- |
| InChIKey | PURRYSQUMXRUPW-NXVVXOECSA-N |
| XLogP | 1.71 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|