C13H13N2O3S- — CID 7176490
2-[(5S)-3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate (PubChem CID 7176490) has the molecular formula C13H13N2O3S- and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[(5S)-3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(5S)-3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 7176490 |
| Molecular Formula | C13H13N2O3S- |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[(5S)-3-ethyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetate |
| SMILES | CCN1C(=O)[C@H](CC(=O)[O-])S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C13H14N2O3S/c1-2-15-12(18)10(8-11(16)17)19-13(15)14-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,16,17)/p-1/b14-13-/t10-/m0/s1 |
| InChIKey | AJXQDJRRPGVYOT-DZOVYVGFSA-M |
| XLogP | 0.78 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|