C17H23N3O2S — CID 40563947
2-[(5R)-2-(3,4-dimethylphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide (PubChem CID 40563947) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-[(5R)-2-(3,4-dimethylphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide.
| Compound Name | 2-[(5R)-2-(3,4-dimethylphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 40563947 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-[(5R)-2-(3,4-dimethylphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@H]1S/C(=N\c2ccc(C)c(C)c2)N(CC)C1=O |
| InChI | InChI=1S/C17H23N3O2S/c1-5-18-15(21)10-14-16(22)20(6-2)17(23-14)19-13-8-7-11(3)12(4)9-13/h7-9,14H,5-6,10H2,1-4H3,(H,18,21)/b19-17-/t14-/m1/s1 |
| InChIKey | OIXPCNIBIZYRAA-RMYFCYLKSA-N |
| XLogP | 2.78 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|