C14H14N2O4S — CID 5182151
2-[2-(3-hydroxyphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 5182151) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[2-(3-hydroxyphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-(3-hydroxyphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 5182151 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[2-(3-hydroxyphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | C=CCN1C(=O)C(CC(=O)O)S/C1=N/c1cccc(O)c1 |
| InChI | InChI=1S/C14H14N2O4S/c1-2-6-16-13(20)11(8-12(18)19)21-14(16)15-9-4-3-5-10(17)7-9/h2-5,7,11,17H,1,6,8H2,(H,18,19)/b15-14+ |
| InChIKey | NGEBCYWUKGCGCQ-CCEZHUSRSA-N |
| XLogP | 1.98 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|