C19H18N2O4S — CID 28776742
2-[(5S)-3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 28776742) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[(5S)-3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5S)-3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 28776742 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[(5S)-3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(CN2C(=O)[C@H](CC(=O)O)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-25-15-9-7-13(8-10-15)12-21-18(24)16(11-17(22)23)26-19(21)20-14-5-3-2-4-6-14/h2-10,16H,11-12H2,1H3,(H,22,23)/b20-19-/t16-/m0/s1 |
| InChIKey | QKHYNHDNPYOJBQ-JVMRMLDLSA-N |
| XLogP | 3.30 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|