C20H20N2O4S — CID 102481576
2-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinan-5-yl]acetic acid (PubChem CID 102481576) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinan-5-yl]acetic acid.
| Compound Name | 2-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 102481576 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinan-5-yl]acetic acid |
| SMILES | COc1ccc(CN2C(=O)C(CC(=O)O)CS/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-26-17-9-7-14(8-10-17)12-22-19(25)15(11-18(23)24)13-27-20(22)21-16-5-3-2-4-6-16/h2-10,15H,11-13H2,1H3,(H,23,24)/b21-20- |
| InChIKey | BGWJHOYUHOFKSB-MRCUWXFGSA-N |
| XLogP | 3.55 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|