C28H29N3O4S — CID 25398429
2-[(5R)-2-(4-ethoxyphenyl)imino-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide (PubChem CID 25398429) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is 2-[(5R)-2-(4-ethoxyphenyl)imino-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5R)-2-(4-ethoxyphenyl)imino-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 25398429 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 2-[(5R)-2-(4-ethoxyphenyl)imino-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCOc1ccc(/N=C2\S[C@H](CC(=O)Nc3cccc4ccccc34)C(=O)N2C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C28H29N3O4S/c1-2-34-21-14-12-20(13-15-21)29-28-31(18-22-9-6-16-35-22)27(33)25(36-28)17-26(32)30-24-11-5-8-19-7-3-4-10-23(19)24/h3-5,7-8,10-15,22,25H,2,6,9,16-18H2,1H3,(H,30,32)/b29-28-/t22-,25-/m1/s1 |
| InChIKey | CLBCQJMOECOEBO-MVKRXISDSA-N |
| XLogP | 5.38 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|