C24H26N4O7S — CID 26860462
N-(4-methoxy-2-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 26860462) has the molecular formula C24H26N4O7S and a molecular weight of 514.56 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 26860462 |
| Molecular Formula | C24H26N4O7S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(/N=C2\S[C@H](CC(=O)Nc3ccc(OC)cc3[N+](=O)[O-])C(=O)N2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H26N4O7S/c1-33-16-7-5-15(6-8-16)25-24-27(14-18-4-3-11-35-18)23(30)21(36-24)13-22(29)26-19-10-9-17(34-2)12-20(19)28(31)32/h5-10,12,18,21H,3-4,11,13-14H2,1-2H3,(H,26,29)/b25-24-/t18-,21+/m0/s1 |
| InChIKey | UPHBUCVDIAKDET-QSUSDHOKSA-N |
| XLogP | 3.75 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|