C25H27N5O8S — CID 3426662
2-[2-(1,3-benzodioxol-5-ylimino)-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 3426662) has the molecular formula C25H27N5O8S and a molecular weight of 557.59 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylimino)-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylimino)-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3426662 |
| Molecular Formula | C25H27N5O8S |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylimino)-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2S/C(=N\c3ccc4c(c3)OCO4)N(CCN3CCOCC3)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H27N5O8S/c1-35-17-3-4-18(19(13-17)30(33)34)27-23(31)14-22-24(32)29(7-6-28-8-10-36-11-9-28)25(39-22)26-16-2-5-20-21(12-16)38-15-37-20/h2-5,12-13,22H,6-11,14-15H2,1H3,(H,27,31)/b26-25- |
| InChIKey | OXEBXVJCTAMSCI-QPLCGJKRSA-N |
| XLogP | 2.62 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|