C20H18N4O7S — CID 135444380
2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 135444380) has the molecular formula C20H18N4O7S and a molecular weight of 458.45 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135444380 |
| Molecular Formula | C20H18N4O7S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-[2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2S/C(=N\c3ccc4c(c3)OCCO4)NC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N4O7S/c1-29-12-3-4-13(14(9-12)24(27)28)22-18(25)10-17-19(26)23-20(32-17)21-11-2-5-15-16(8-11)31-7-6-30-15/h2-5,8-9,17H,6-7,10H2,1H3,(H,22,25)(H,21,23,26) |
| InChIKey | CROOLYNXGWEQHM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|