C19H17ClN4O5S — CID 136828528
2-[(5S)-2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 136828528) has the molecular formula C19H17ClN4O5S and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-[(5S)-2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[(5S)-2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 136828528 |
| Molecular Formula | C19H17ClN4O5S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[(5S)-2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[C@@H]2S/C(=N/c3ccc(Cl)cc3C)NC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17ClN4O5S/c1-10-7-11(20)3-5-13(10)22-19-23-18(26)16(30-19)9-17(25)21-14-6-4-12(29-2)8-15(14)24(27)28/h3-8,16H,9H2,1-2H3,(H,21,25)(H,22,23,26)/t16-/m0/s1 |
| InChIKey | BNODKUWAGFYKQY-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|