C18H18ClN5O6S — CID 135720458
4-[[2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 135720458) has the molecular formula C18H18ClN5O6S and a molecular weight of 467.89 g/mol. Its IUPAC name is 4-[[2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-[[2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 135720458 |
| Molecular Formula | C18H18ClN5O6S |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 4-[[2-[2-(4-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | Cc1cc(Cl)ccc1/N=C1/NC(=O)C(CC(=O)Nc2ccc([NH+]([O-])O)cc2[NH+]([O-])O)S1 |
| InChI | InChI=1S/C18H18ClN5O6S/c1-9-6-10(19)2-4-12(9)21-18-22-17(26)15(31-18)8-16(25)20-13-5-3-11(23(27)28)7-14(13)24(29)30/h2-7,15,23-24,27,29H,8H2,1H3,(H,20,25)(H,21,22,26) |
| InChIKey | PRSGXSXTGCOCGK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|