C16H14ClN5O6S — CID 135720456
4-[[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidine-5-carbonyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 135720456) has the molecular formula C16H14ClN5O6S and a molecular weight of 439.84 g/mol. Its IUPAC name is 4-[[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidine-5-carbonyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-[[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidine-5-carbonyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 135720456 |
| Molecular Formula | C16H14ClN5O6S |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-[[2-(2-chlorophenyl)imino-4-oxo-1,3-thiazolidine-5-carbonyl]amino]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | O=C1N/C(=N/c2ccccc2Cl)SC1C(=O)Nc1ccc([NH+]([O-])O)cc1[NH+]([O-])O |
| InChI | InChI=1S/C16H14ClN5O6S/c17-9-3-1-2-4-10(9)19-16-20-15(24)13(29-16)14(23)18-11-6-5-8(21(25)26)7-12(11)22(27)28/h1-7,13,21-22,25,27H,(H,18,23)(H,19,20,24) |
| InChIKey | MOEBHMZCDDRONX-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|