C13H16N8O9 — CID 21157828
4-[2-[[2,4-bis[hydroxy(oxido)azaniumyl]phenyl]iminocarbamoyl]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 21157828) has the molecular formula C13H16N8O9 and a molecular weight of 428.32 g/mol. Its IUPAC name is 4-[2-[[2,4-bis[hydroxy(oxido)azaniumyl]phenyl]iminocarbamoyl]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-[2-[[2,4-bis[hydroxy(oxido)azaniumyl]phenyl]iminocarbamoyl]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 21157828 |
| Molecular Formula | C13H16N8O9 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-[2-[[2,4-bis[hydroxy(oxido)azaniumyl]phenyl]iminocarbamoyl]hydrazinyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | O=C(/N=N/c1ccc([NH+]([O-])O)cc1[NH+]([O-])O)NNc1ccc([NH+]([O-])O)cc1[NH+]([O-])O |
| InChI | InChI=1S/C13H16N8O9/c22-13(16-14-9-3-1-7(18(23)24)5-11(9)20(27)28)17-15-10-4-2-8(19(25)26)6-12(10)21(29)30/h1-6,14,18-21,23,25,27,29H,(H,16,22)/b17-15+ |
| InChIKey | KRCAFDPTAQCBFM-BMRADRMJSA-N |
| XLogP | -2.88 |
| TPSA | 256.77 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|