C14H16N4O6 — CID 163123532
1-N,3-N-dihydroxy-5-[(2-methoxyphenyl)carbamoylamino]benzene-1,3-diamine oxide (PubChem CID 163123532) has the molecular formula C14H16N4O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-5-[(2-methoxyphenyl)carbamoylamino]benzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dihydroxy-5-[(2-methoxyphenyl)carbamoylamino]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163123532 |
| Molecular Formula | C14H16N4O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-N,3-N-dihydroxy-5-[(2-methoxyphenyl)carbamoylamino]benzene-1,3-diamine oxide |
| SMILES | COc1ccccc1NC(=O)Nc1cc([NH+]([O-])O)cc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C14H16N4O6/c1-24-13-5-3-2-4-12(13)16-14(19)15-9-6-10(17(20)21)8-11(7-9)18(22)23/h2-8,17-18,20,22H,1H3,(H2,15,16,19) |
| InChIKey | CJXOSUHRTRIFSP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|