C15H15N2O2 — CID 168763596
CID 168763596 (PubChem CID 168763596) has the molecular formula C15H15N2O2 and a molecular weight of 255.30 g/mol.
| Compound Name | CID 168763596 |
|---|---|
| PubChem CID | 168763596 |
| Molecular Formula | C15H15N2O2 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc(NC(=O)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C15H15N2O2/c1-11-7-9-12(10-8-11)16-15(18)17-13-5-3-4-6-14(13)19-2/h3-10H,1H2,2H3,(H2,16,17,18) |
| InChIKey | PUJVSWBTSRZJIX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |