C20H16BrN3O3 — CID 163180106
3-[[[(2-bromophenyl)-phenylmethylidene]amino]carbamoyl]-N-hydroxybenzeneamine oxide (PubChem CID 163180106) has the molecular formula C20H16BrN3O3 and a molecular weight of 426.27 g/mol. Its IUPAC name is 3-[[[(2-bromophenyl)-phenylmethylidene]amino]carbamoyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[[[(2-bromophenyl)-phenylmethylidene]amino]carbamoyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163180106 |
| Molecular Formula | C20H16BrN3O3 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 3-[[[(2-bromophenyl)-phenylmethylidene]amino]carbamoyl]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(NN=C(c1ccccc1)c1ccccc1Br)c1cccc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C20H16BrN3O3/c21-18-12-5-4-11-17(18)19(14-7-2-1-3-8-14)22-23-20(25)15-9-6-10-16(13-15)24(26)27/h1-13,24,26H,(H,23,25) |
| InChIKey | YTXLQFGOCSDULX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|