C22H19N5O5 — CID 3090062
N-[[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-3,5-dinitrobenzamide (PubChem CID 3090062) has the molecular formula C22H19N5O5 and a molecular weight of 433.42 g/mol. Its IUPAC name is N-[[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-3,5-dinitrobenzamide.
| Compound Name | N-[[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3090062 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[[[4-(dimethylamino)phenyl]-phenylmethylidene]amino]-3,5-dinitrobenzamide |
| SMILES | CN(C)c1ccc(C(=NNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N5O5/c1-25(2)18-10-8-16(9-11-18)21(15-6-4-3-5-7-15)23-24-22(28)17-12-19(26(29)30)14-20(13-17)27(31)32/h3-14H,1-2H3,(H,24,28) |
| InChIKey | GTXIXGTWKPTLBB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|