C14H11N5O5 — CID 40532157
3,5-dinitro-N-[(Z)-1-pyridin-2-ylethylideneamino]benzamide (PubChem CID 40532157) has the molecular formula C14H11N5O5 and a molecular weight of 329.27 g/mol. Its IUPAC name is 3,5-dinitro-N-[(Z)-1-pyridin-2-ylethylideneamino]benzamide.
| Compound Name | 3,5-dinitro-N-[(Z)-1-pyridin-2-ylethylideneamino]benzamide |
|---|---|
| PubChem CID | 40532157 |
| Molecular Formula | C14H11N5O5 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3,5-dinitro-N-[(Z)-1-pyridin-2-ylethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccn1 |
| InChI | InChI=1S/C14H11N5O5/c1-9(13-4-2-3-5-15-13)16-17-14(20)10-6-11(18(21)22)8-12(7-10)19(23)24/h2-8H,1H3,(H,17,20)/b16-9- |
| InChIKey | XZAADFVFTKZGCZ-SXGWCWSVSA-N |
| XLogP | 2.05 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|