C16H16N6O4 — CID 171979086
3-amino-5-nitro-N-[(E)-[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]benzamide (PubChem CID 171979086) has the molecular formula C16H16N6O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is 3-amino-5-nitro-N-[(E)-[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]benzamide.
| Compound Name | 3-amino-5-nitro-N-[(E)-[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 171979086 |
| Molecular Formula | C16H16N6O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-amino-5-nitro-N-[(E)-[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]benzamide |
| SMILES | C/C(CC(=O)Nc1ccccn1)=N\NC(=O)c1cc(N)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N6O4/c1-10(6-15(23)19-14-4-2-3-5-18-14)20-21-16(24)11-7-12(17)9-13(8-11)22(25)26/h2-5,7-9H,6,17H2,1H3,(H,21,24)(H,18,19,23)/b20-10+ |
| InChIKey | NNLDPVRXGKEKLS-KEBDBYFISA-N |
| XLogP | 1.71 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|