C15H21N5O3 — CID 4610512
N-tert-butyl-N'-[[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]oxamide (PubChem CID 4610512) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is N-tert-butyl-N'-[[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]oxamide.
| Compound Name | N-tert-butyl-N'-[[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 4610512 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-tert-butyl-N'-[[4-oxo-4-(pyridin-2-ylamino)butan-2-ylidene]amino]oxamide |
| SMILES | CC(CC(=O)Nc1ccccn1)=NNC(=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H21N5O3/c1-10(9-12(21)17-11-7-5-6-8-16-11)19-20-14(23)13(22)18-15(2,3)4/h5-8H,9H2,1-4H3,(H,18,22)(H,20,23)(H,16,17,21) |
| InChIKey | UHNUILNJIHYWQL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|