C14H19N5O3 — CID 3129985
N'-[[4-oxo-4-(propylamino)butan-2-ylidene]amino]-N-pyridin-2-yloxamide (PubChem CID 3129985) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is N'-[[4-oxo-4-(propylamino)butan-2-ylidene]amino]-N-pyridin-2-yloxamide.
| Compound Name | N'-[[4-oxo-4-(propylamino)butan-2-ylidene]amino]-N-pyridin-2-yloxamide |
|---|---|
| PubChem CID | 3129985 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N'-[[4-oxo-4-(propylamino)butan-2-ylidene]amino]-N-pyridin-2-yloxamide |
| SMILES | CCCNC(=O)CC(C)=NNC(=O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C14H19N5O3/c1-3-7-16-12(20)9-10(2)18-19-14(22)13(21)17-11-6-4-5-8-15-11/h4-6,8H,3,7,9H2,1-2H3,(H,16,20)(H,19,22)(H,15,17,21) |
| InChIKey | VWFNYHAUGFHPFX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|