C10H13N3O3 — CID 44999298
N-(2-hydroxypropyl)-N'-pyridin-2-yloxamide (PubChem CID 44999298) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N'-pyridin-2-yloxamide.
| Compound Name | N-(2-hydroxypropyl)-N'-pyridin-2-yloxamide |
|---|---|
| PubChem CID | 44999298 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-(2-hydroxypropyl)-N'-pyridin-2-yloxamide |
| SMILES | CC(O)CNC(=O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C10H13N3O3/c1-7(14)6-12-9(15)10(16)13-8-4-2-3-5-11-8/h2-5,7,14H,6H2,1H3,(H,12,15)(H,11,13,16) |
| InChIKey | MIPPKZRAGLNWMP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|