C11H14N4O3 — CID 108525918
N-(3-formamidopropyl)-N'-pyridin-2-yloxamide (PubChem CID 108525918) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is N-(3-formamidopropyl)-N'-pyridin-2-yloxamide.
| Compound Name | N-(3-formamidopropyl)-N'-pyridin-2-yloxamide |
|---|---|
| PubChem CID | 108525918 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(3-formamidopropyl)-N'-pyridin-2-yloxamide |
| SMILES | O=CNCCCNC(=O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C11H14N4O3/c16-8-12-5-3-7-14-10(17)11(18)15-9-4-1-2-6-13-9/h1-2,4,6,8H,3,5,7H2,(H,12,16)(H,14,17)(H,13,15,18) |
| InChIKey | POTQJYGQMWBGLA-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|