C11H17N5O2 — CID 70213624
(2S)-2-amino-5-(carbamoylamino)-N-pyridin-2-ylpentanamide (PubChem CID 70213624) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)-N-pyridin-2-ylpentanamide.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)-N-pyridin-2-ylpentanamide |
|---|---|
| PubChem CID | 70213624 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)-N-pyridin-2-ylpentanamide |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C11H17N5O2/c12-8(4-3-7-15-11(13)18)10(17)16-9-5-1-2-6-14-9/h1-2,5-6,8H,3-4,7,12H2,(H3,13,15,18)(H,14,16,17)/t8-/m0/s1 |
| InChIKey | BAIYMABPYWKAAW-QMMMGPOBSA-N |
| XLogP | -0.20 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|