C28H34N4O5S — CID 146572168
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2R)-2-amino-3-tritylsulfanylpropanoic acid (PubChem CID 146572168) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2R)-2-amino-3-tritylsulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2R)-2-amino-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 146572168 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;(2R)-2-amino-3-tritylsulfanylpropanoic acid |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)O.N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H21NO2S.C6H13N3O3/c23-20(21(24)25)16-26-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;7-4(5(10)11)2-1-3-9-6(8)12/h1-15,20H,16,23H2,(H,24,25);4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t20-;4-/m00/s1 |
| InChIKey | MVARWSONLKIWRC-HKWFEGLRSA-N |
| XLogP | 2.97 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|