C22H20ClNO2S — CID 57326474
(2R)-2-amino-3-[(3-chlorophenyl)-diphenylmethyl]sulfanylpropanoic acid (PubChem CID 57326474) has the molecular formula C22H20ClNO2S and a molecular weight of 397.93 g/mol. Its IUPAC name is (2R)-2-amino-3-[(3-chlorophenyl)-diphenylmethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[(3-chlorophenyl)-diphenylmethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57326474 |
| Molecular Formula | C22H20ClNO2S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (2R)-2-amino-3-[(3-chlorophenyl)-diphenylmethyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C22H20ClNO2S/c23-19-13-7-12-18(14-19)22(16-8-3-1-4-9-16,17-10-5-2-6-11-17)27-15-20(24)21(25)26/h1-14,20H,15,24H2,(H,25,26)/t20-/m0/s1 |
| InChIKey | ACJYMJDGPOZZLK-FQEVSTJZSA-N |
| XLogP | 4.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|