C24H25NO2S — CID 71664710
2-amino-3-[(3,4-dimethylphenyl)-diphenylmethyl]sulfanylpropanoic acid (PubChem CID 71664710) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-amino-3-[(3,4-dimethylphenyl)-diphenylmethyl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[(3,4-dimethylphenyl)-diphenylmethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 71664710 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-amino-3-[(3,4-dimethylphenyl)-diphenylmethyl]sulfanylpropanoic acid |
| SMILES | Cc1ccc(C(SCC(N)C(=O)O)(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C24H25NO2S/c1-17-13-14-21(15-18(17)2)24(19-9-5-3-6-10-19,20-11-7-4-8-12-20)28-16-22(25)23(26)27/h3-15,22H,16,25H2,1-2H3,(H,26,27) |
| InChIKey | FJGPSDKLLKURQL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|