C22H21NO3S — CID 24860496
(2R)-2-amino-3-[(4-hydroxyphenyl)-diphenylmethyl]sulfanylpropanoic acid (PubChem CID 24860496) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (2R)-2-amino-3-[(4-hydroxyphenyl)-diphenylmethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[(4-hydroxyphenyl)-diphenylmethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 24860496 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2R)-2-amino-3-[(4-hydroxyphenyl)-diphenylmethyl]sulfanylpropanoic acid |
| SMILES | N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H21NO3S/c23-20(21(25)26)15-27-22(16-7-3-1-4-8-16,17-9-5-2-6-10-17)18-11-13-19(24)14-12-18/h1-14,20,24H,15,23H2,(H,25,26)/t20-/m0/s1 |
| InChIKey | AOGPWKNXGPIRNB-FQEVSTJZSA-N |
| XLogP | 3.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|