C23H24N2O2S — CID 71170093
(2R)-2-amino-3-[(4-methoxyphenyl)-diphenylmethyl]sulfanylpropanamide (PubChem CID 71170093) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (2R)-2-amino-3-[(4-methoxyphenyl)-diphenylmethyl]sulfanylpropanamide.
| Compound Name | (2R)-2-amino-3-[(4-methoxyphenyl)-diphenylmethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 71170093 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (2R)-2-amino-3-[(4-methoxyphenyl)-diphenylmethyl]sulfanylpropanamide |
| SMILES | COc1ccc(C(SC[C@H](N)C(N)=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-27-20-14-12-19(13-15-20)23(17-8-4-2-5-9-17,18-10-6-3-7-11-18)28-16-21(24)22(25)26/h2-15,21H,16,24H2,1H3,(H2,25,26)/t21-/m0/s1 |
| InChIKey | FZHTUTSKHRUFFE-NRFANRHFSA-N |
| XLogP | 3.53 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|