C29H31NO6S — CID 160782438
(2R)-2-[(2R)-2-acetamido-3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]sulfanylpropanoyl]oxypropanoic acid (PubChem CID 160782438) has the molecular formula C29H31NO6S and a molecular weight of 521.64 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-acetamido-3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]sulfanylpropanoyl]oxypropanoic acid.
| Compound Name | (2R)-2-[(2R)-2-acetamido-3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]sulfanylpropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 160782438 |
| Molecular Formula | C29H31NO6S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (2R)-2-[(2R)-2-acetamido-3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]sulfanylpropanoyl]oxypropanoic acid |
| SMILES | COc1ccc(C(SC[C@H](NC(C)=O)C(=O)O[C@H](C)C(=O)O)(c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H31NO6S/c1-19-10-12-23(13-11-19)29(22-8-6-5-7-9-22,24-14-16-25(35-4)17-15-24)37-18-26(30-21(3)31)28(34)36-20(2)27(32)33/h5-17,20,26H,18H2,1-4H3,(H,30,31)(H,32,33)/t20-,26+,29?/m1/s1 |
| InChIKey | UAHHZOZNYFDLLU-QMQOABTMSA-N |
| XLogP | 4.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|