C33H39NO4S — CID 159534272
methyl (2R)-2-[[(5S,6S)-5,6-dimethyl-4-oxooctanoyl]amino]-3-tritylsulfanylpropanoate (PubChem CID 159534272) has the molecular formula C33H39NO4S and a molecular weight of 545.75 g/mol. Its IUPAC name is methyl (2R)-2-[[(5S,6S)-5,6-dimethyl-4-oxooctanoyl]amino]-3-tritylsulfanylpropanoate.
| Compound Name | methyl (2R)-2-[[(5S,6S)-5,6-dimethyl-4-oxooctanoyl]amino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 159534272 |
| Molecular Formula | C33H39NO4S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | methyl (2R)-2-[[(5S,6S)-5,6-dimethyl-4-oxooctanoyl]amino]-3-tritylsulfanylpropanoate |
| SMILES | CC[C@H](C)[C@H](C)C(=O)CCC(=O)N[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C33H39NO4S/c1-5-24(2)25(3)30(35)21-22-31(36)34-29(32(37)38-4)23-39-33(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,24-25,29H,5,21-23H2,1-4H3,(H,34,36)/t24-,25-,29-/m0/s1 |
| InChIKey | MDJSZDSGOUVNJV-QEMZJVQQSA-N |
| XLogP | 6.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|