C47H46N2O3S2 — CID 70282038
ethyl (2R)-3-tritylsulfanyl-2-[[2-(2-tritylsulfanylethylamino)acetyl]amino]propanoate (PubChem CID 70282038) has the molecular formula C47H46N2O3S2 and a molecular weight of 751.03 g/mol. Its IUPAC name is ethyl (2R)-3-tritylsulfanyl-2-[[2-(2-tritylsulfanylethylamino)acetyl]amino]propanoate.
| Compound Name | ethyl (2R)-3-tritylsulfanyl-2-[[2-(2-tritylsulfanylethylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 70282038 |
| Molecular Formula | C47H46N2O3S2 |
| Molecular Weight | 751.03 g/mol |
| Exact Mass | 750.29 |
| IUPAC Name | ethyl (2R)-3-tritylsulfanyl-2-[[2-(2-tritylsulfanylethylamino)acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CNCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H46N2O3S2/c1-2-52-45(51)43(36-54-47(40-27-15-6-16-28-40,41-29-17-7-18-30-41)42-31-19-8-20-32-42)49-44(50)35-48-33-34-53-46(37-21-9-3-10-22-37,38-23-11-4-12-24-38)39-25-13-5-14-26-39/h3-32,43,48H,2,33-36H2,1H3,(H,49,50)/t43-/m0/s1 |
| InChIKey | OIAXQOMPGKNMNX-QLKFWGTOSA-N |
| XLogP | 9.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.03 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|