C32H36ClN3O3S2 — CID 139669850
ethyl (2R)-2-[[2-(1H-imidazol-2-ylmethylsulfanyl)-2-methylpropanoyl]amino]-3-tritylsulfanylpropanoate;hydrochloride (PubChem CID 139669850) has the molecular formula C32H36ClN3O3S2 and a molecular weight of 610.25 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-(1H-imidazol-2-ylmethylsulfanyl)-2-methylpropanoyl]amino]-3-tritylsulfanylpropanoate;hydrochloride.
| Compound Name | ethyl (2R)-2-[[2-(1H-imidazol-2-ylmethylsulfanyl)-2-methylpropanoyl]amino]-3-tritylsulfanylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 139669850 |
| Molecular Formula | C32H36ClN3O3S2 |
| Molecular Weight | 610.25 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | ethyl (2R)-2-[[2-(1H-imidazol-2-ylmethylsulfanyl)-2-methylpropanoyl]amino]-3-tritylsulfanylpropanoate;hydrochloride |
| SMILES | CCOC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(C)(C)SCc1ncc[nH]1.Cl |
| InChI | InChI=1S/C32H35N3O3S2.ClH/c1-4-38-29(36)27(35-30(37)31(2,3)39-23-28-33-20-21-34-28)22-40-32(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26;/h5-21,27H,4,22-23H2,1-3H3,(H,33,34)(H,35,37);1H/t27-;/m0./s1 |
| InChIKey | DDTNHKVJOJQGHB-YCBFMBTMSA-N |
| XLogP | 6.62 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.25 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|