C50H50N2O5S — CID 99653819
diethyl (2R)-2-[[(2R)-2-(tritylamino)-3-tritylsulfanylpropanoyl]amino]pentanedioate (PubChem CID 99653819) has the molecular formula C50H50N2O5S and a molecular weight of 791.03 g/mol. Its IUPAC name is diethyl (2R)-2-[[(2R)-2-(tritylamino)-3-tritylsulfanylpropanoyl]amino]pentanedioate.
| Compound Name | diethyl (2R)-2-[[(2R)-2-(tritylamino)-3-tritylsulfanylpropanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 99653819 |
| Molecular Formula | C50H50N2O5S |
| Molecular Weight | 791.03 g/mol |
| Exact Mass | 790.34 |
| IUPAC Name | diethyl (2R)-2-[[(2R)-2-(tritylamino)-3-tritylsulfanylpropanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C50H50N2O5S/c1-3-56-46(53)36-35-44(48(55)57-4-2)51-47(54)45(52-49(38-23-11-5-12-24-38,39-25-13-6-14-26-39)40-27-15-7-16-28-40)37-58-50(41-29-17-8-18-30-41,42-31-19-9-20-32-42)43-33-21-10-22-34-43/h5-34,44-45,52H,3-4,35-37H2,1-2H3,(H,51,54)/t44-,45+/m1/s1 |
| InChIKey | HXQMEXBMQABZTD-UVTBUIGASA-N |
| XLogP | 9.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.03 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|