C30H29NO3 — CID 22961284
ethyl 3-phenoxy-2-(tritylamino)propanoate (PubChem CID 22961284) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl 3-phenoxy-2-(tritylamino)propanoate.
| Compound Name | ethyl 3-phenoxy-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 22961284 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | ethyl 3-phenoxy-2-(tritylamino)propanoate |
| SMILES | CCOC(=O)C(COc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29NO3/c1-2-33-29(32)28(23-34-27-21-13-6-14-22-27)31-30(24-15-7-3-8-16-24,25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,28,31H,2,23H2,1H3 |
| InChIKey | YMFLHKRURPRATA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|