C34H46N2O4SSi — CID 10769998
ethyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2S)-3-methoxy-2-(tritylamino)propanethioyl]amino]propanoate (PubChem CID 10769998) has the molecular formula C34H46N2O4SSi and a molecular weight of 606.91 g/mol. Its IUPAC name is ethyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2S)-3-methoxy-2-(tritylamino)propanethioyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2S)-3-methoxy-2-(tritylamino)propanethioyl]amino]propanoate |
|---|---|
| PubChem CID | 10769998 |
| Molecular Formula | C34H46N2O4SSi |
| Molecular Weight | 606.91 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | ethyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(2S)-3-methoxy-2-(tritylamino)propanethioyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)NC(=S)[C@H](COC)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H46N2O4SSi/c1-8-39-32(37)30(25-40-42(6,7)33(2,3)4)35-31(41)29(24-38-5)36-34(26-18-12-9-13-19-26,27-20-14-10-15-21-27)28-22-16-11-17-23-28/h9-23,29-30,36H,8,24-25H2,1-7H3,(H,35,41)/t29-,30-/m0/s1 |
| InChIKey | FSCIRHXDGMECNP-KYJUHHDHSA-N |
| XLogP | 6.45 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.91 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|