C36H47NO4 — CID 90367502
ditert-butyl (2S,4S)-2-butyl-4-(tritylamino)pentanedioate (PubChem CID 90367502) has the molecular formula C36H47NO4 and a molecular weight of 557.78 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-butyl-4-(tritylamino)pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-butyl-4-(tritylamino)pentanedioate |
|---|---|
| PubChem CID | 90367502 |
| Molecular Formula | C36H47NO4 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | ditert-butyl (2S,4S)-2-butyl-4-(tritylamino)pentanedioate |
| SMILES | CCCC[C@@H](C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H47NO4/c1-8-9-19-27(32(38)40-34(2,3)4)26-31(33(39)41-35(5,6)7)37-36(28-20-13-10-14-21-28,29-22-15-11-16-23-29)30-24-17-12-18-25-30/h10-18,20-25,27,31,37H,8-9,19,26H2,1-7H3/t27-,31-/m0/s1 |
| InChIKey | SBHSWOLDWPUGPV-DHIFEGFHSA-N |
| XLogP | 7.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|