C35H44FNO4 — CID 71469051
ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-(tritylamino)pentanedioate (PubChem CID 71469051) has the molecular formula C35H44FNO4 and a molecular weight of 561.74 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-(tritylamino)pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-(tritylamino)pentanedioate |
|---|---|
| PubChem CID | 71469051 |
| Molecular Formula | C35H44FNO4 |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-(tritylamino)pentanedioate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCCF)C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H44FNO4/c1-33(2,3)40-31(38)26(17-16-24-36)25-30(32(39)41-34(4,5)6)37-35(27-18-10-7-11-19-27,28-20-12-8-13-21-28)29-22-14-9-15-23-29/h7-15,18-23,26,30,37H,16-17,24-25H2,1-6H3/t26-,30-/m0/s1 |
| InChIKey | NNNACSVBAUAZTJ-YZNIXAGQSA-N |
| XLogP | 7.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|