C33H43NO5Si — CID 70941521
(2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(tritylamino)pentanedioic acid (PubChem CID 70941521) has the molecular formula C33H43NO5Si and a molecular weight of 561.80 g/mol. Its IUPAC name is (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(tritylamino)pentanedioic acid.
| Compound Name | (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(tritylamino)pentanedioic acid |
|---|---|
| PubChem CID | 70941521 |
| Molecular Formula | C33H43NO5Si |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(tritylamino)pentanedioic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@H](C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C33H43NO5Si/c1-32(2,3)40(4,5)39-23-15-16-25(30(35)36)24-29(31(37)38)34-33(26-17-9-6-10-18-26,27-19-11-7-12-20-27)28-21-13-8-14-22-28/h6-14,17-22,25,29,34H,15-16,23-24H2,1-5H3,(H,35,36)(H,37,38)/t25-,29-/m0/s1 |
| InChIKey | SFDFBPOBKWJOJO-SVEHJYQDSA-N |
| XLogP | 6.91 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|