C24H25NO3 — CID 51341708
(2R)-4-methoxy-2-(tritylamino)butanoic acid (PubChem CID 51341708) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R)-4-methoxy-2-(tritylamino)butanoic acid.
| Compound Name | (2R)-4-methoxy-2-(tritylamino)butanoic acid |
|---|---|
| PubChem CID | 51341708 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2R)-4-methoxy-2-(tritylamino)butanoic acid |
| SMILES | COCC[C@@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H25NO3/c1-28-18-17-22(23(26)27)25-24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22,25H,17-18H2,1H3,(H,26,27)/t22-/m1/s1 |
| InChIKey | DLEJPBOUWYFFOO-JOCHJYFZSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|