C25H26NO6P — CID 23187092
[5-methoxy-2,5-dioxo-4-(tritylamino)pentyl]phosphonic acid (PubChem CID 23187092) has the molecular formula C25H26NO6P and a molecular weight of 467.46 g/mol. Its IUPAC name is [5-methoxy-2,5-dioxo-4-(tritylamino)pentyl]phosphonic acid.
| Compound Name | [5-methoxy-2,5-dioxo-4-(tritylamino)pentyl]phosphonic acid |
|---|---|
| PubChem CID | 23187092 |
| Molecular Formula | C25H26NO6P |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [5-methoxy-2,5-dioxo-4-(tritylamino)pentyl]phosphonic acid |
| SMILES | COC(=O)C(CC(=O)CP(=O)(O)O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26NO6P/c1-32-24(28)23(17-22(27)18-33(29,30)31)26-25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,23,26H,17-18H2,1H3,(H2,29,30,31) |
| InChIKey | UHWGJZCBDJVMDS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|